C19H18N2O3 — CID 67437322
(5S)-5-hydroxy-6,6-dimethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazinan-2-one (PubChem CID 67437322) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (5S)-5-hydroxy-6,6-dimethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazinan-2-one.
| Compound Name | (5S)-5-hydroxy-6,6-dimethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 67437322 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (5S)-5-hydroxy-6,6-dimethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazinan-2-one |
| SMILES | CC1(C)OC(=O)N(c2ccc(C#Cc3ccccc3)cn2)C[C@@H]1O |
| InChI | InChI=1S/C19H18N2O3/c1-19(2)16(22)13-21(18(23)24-19)17-11-10-15(12-20-17)9-8-14-6-4-3-5-7-14/h3-7,10-12,16,22H,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | DCYFLSDRPJLIEY-INIZCTEOSA-N |
| XLogP | 2.58 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|