C20H20N2O2 — CID 123142459
4,5-diethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazolidin-2-one (PubChem CID 123142459) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4,5-diethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazolidin-2-one.
| Compound Name | 4,5-diethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123142459 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4,5-diethyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-1,3-oxazolidin-2-one |
| SMILES | CCC1OC(=O)N(c2ccc(C#Cc3ccccc3)cn2)C1CC |
| InChI | InChI=1S/C20H20N2O2/c1-3-17-18(4-2)24-20(23)22(17)19-13-12-16(14-21-19)11-10-15-8-6-5-7-9-15/h5-9,12-14,17-18H,3-4H2,1-2H3 |
| InChIKey | DJTFLAKGBQUVPV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|