C18H19N3 — CID 152538841
2-(3,3-dimethylpyrazolidin-1-yl)-5-(2-phenylethynyl)pyridine (PubChem CID 152538841) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(3,3-dimethylpyrazolidin-1-yl)-5-(2-phenylethynyl)pyridine.
| Compound Name | 2-(3,3-dimethylpyrazolidin-1-yl)-5-(2-phenylethynyl)pyridine |
|---|---|
| PubChem CID | 152538841 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-(3,3-dimethylpyrazolidin-1-yl)-5-(2-phenylethynyl)pyridine |
| SMILES | CC1(C)CCN(c2ccc(C#Cc3ccccc3)cn2)N1 |
| InChI | InChI=1S/C18H19N3/c1-18(2)12-13-21(20-18)17-11-10-16(14-19-17)9-8-15-6-4-3-5-7-15/h3-7,10-11,14,20H,12-13H2,1-2H3 |
| InChIKey | YLCLEQISBJHXDZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|