C22H26N2 — CID 141314304
2-(5-tert-butyl-5-methylpyrrolidin-3-yl)-5-(2-phenylethynyl)pyridine (PubChem CID 141314304) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-(5-tert-butyl-5-methylpyrrolidin-3-yl)-5-(2-phenylethynyl)pyridine.
| Compound Name | 2-(5-tert-butyl-5-methylpyrrolidin-3-yl)-5-(2-phenylethynyl)pyridine |
|---|---|
| PubChem CID | 141314304 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-(5-tert-butyl-5-methylpyrrolidin-3-yl)-5-(2-phenylethynyl)pyridine |
| SMILES | CC(C)(C)C1(C)CC(c2ccc(C#Cc3ccccc3)cn2)CN1 |
| InChI | InChI=1S/C22H26N2/c1-21(2,3)22(4)14-19(16-24-22)20-13-12-18(15-23-20)11-10-17-8-6-5-7-9-17/h5-9,12-13,15,19,24H,14,16H2,1-4H3 |
| InChIKey | RILAAJYHGVEXCO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|