C21H23N — CID 67458263
2-[(1R,3R)-3-ethylcyclohexyl]-5-(2-phenylethynyl)pyridine (PubChem CID 67458263) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-[(1R,3R)-3-ethylcyclohexyl]-5-(2-phenylethynyl)pyridine.
| Compound Name | 2-[(1R,3R)-3-ethylcyclohexyl]-5-(2-phenylethynyl)pyridine |
|---|---|
| PubChem CID | 67458263 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[(1R,3R)-3-ethylcyclohexyl]-5-(2-phenylethynyl)pyridine |
| SMILES | CC[C@@H]1CCC[C@@H](c2ccc(C#Cc3ccccc3)cn2)C1 |
| InChI | InChI=1S/C21H23N/c1-2-17-9-6-10-20(15-17)21-14-13-19(16-22-21)12-11-18-7-4-3-5-8-18/h3-5,7-8,13-14,16-17,20H,2,6,9-10,15H2,1H3/t17-,20-/m1/s1 |
| InChIKey | YPLRKSMRQZFTKJ-YLJYHZDGSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|