C22H24N2O — CID 141314277
5-tert-butyl-5-methyl-3-[5-(2-phenylethynyl)-2-pyridinyl]pyrrolidin-2-one (PubChem CID 141314277) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 5-tert-butyl-5-methyl-3-[5-(2-phenylethynyl)-2-pyridinyl]pyrrolidin-2-one.
| Compound Name | 5-tert-butyl-5-methyl-3-[5-(2-phenylethynyl)-2-pyridinyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141314277 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 5-tert-butyl-5-methyl-3-[5-(2-phenylethynyl)-2-pyridinyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)C1(C)CC(c2ccc(C#Cc3ccccc3)cn2)C(=O)N1 |
| InChI | InChI=1S/C22H24N2O/c1-21(2,3)22(4)14-18(20(25)24-22)19-13-12-17(15-23-19)11-10-16-8-6-5-7-9-16/h5-9,12-13,15,18H,14H2,1-4H3,(H,24,25) |
| InChIKey | ITVKQNGXMZNJDA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|