C21H21N3O — CID 58464032
1-methyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one (PubChem CID 58464032) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-methyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one.
| Compound Name | 1-methyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 58464032 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-methyl-3-[5-(2-phenylethynyl)-2-pyridinyl]-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-one |
| SMILES | CN1C(=O)N(c2ccc(C#Cc3ccccc3)cn2)C2CCCCC21 |
| InChI | InChI=1S/C21H21N3O/c1-23-18-9-5-6-10-19(18)24(21(23)25)20-14-13-17(15-22-20)12-11-16-7-3-2-4-8-16/h2-4,7-8,13-15,18-19H,5-6,9-10H2,1H3 |
| InChIKey | NEJNZWMONLOGMV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|