C20H20N2O2 — CID 123650612
3-[5-(2-phenylethynyl)-2-pyridinyl]-5-propyl-1,3-oxazinan-2-one (PubChem CID 123650612) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-[5-(2-phenylethynyl)-2-pyridinyl]-5-propyl-1,3-oxazinan-2-one.
| Compound Name | 3-[5-(2-phenylethynyl)-2-pyridinyl]-5-propyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 123650612 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-[5-(2-phenylethynyl)-2-pyridinyl]-5-propyl-1,3-oxazinan-2-one |
| SMILES | CCCC1COC(=O)N(c2ccc(C#Cc3ccccc3)cn2)C1 |
| InChI | InChI=1S/C20H20N2O2/c1-2-6-18-14-22(20(23)24-15-18)19-12-11-17(13-21-19)10-9-16-7-4-3-5-8-16/h3-5,7-8,11-13,18H,2,6,14-15H2,1H3 |
| InChIKey | XQZYORMJYOSLDZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|