C33H37FO4 — CID 141209369
tert-butyl 4-(fluoromethyl)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2-tritylpent-4-enoate (PubChem CID 141209369) has the molecular formula C33H37FO4 and a molecular weight of 516.65 g/mol. Its IUPAC name is tert-butyl 4-(fluoromethyl)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2-tritylpent-4-enoate.
| Compound Name | tert-butyl 4-(fluoromethyl)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2-tritylpent-4-enoate |
|---|---|
| PubChem CID | 141209369 |
| Molecular Formula | C33H37FO4 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | tert-butyl 4-(fluoromethyl)-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2-tritylpent-4-enoate |
| SMILES | CC(C)(C)OC(=O)C(CC(=C=O)CF)(OC(C)(C)C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37FO4/c1-30(2,3)37-29(36)32(38-31(4,5)6,22-25(23-34)24-35)33(26-16-10-7-11-17-26,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-21H,22-23H2,1-6H3 |
| InChIKey | ORHPEJRRXYBXGE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|