C9H9F3O3S — CID 141210228
1-(3,3,3-trifluoroprop-1-enyl)cyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 141210228) has the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. Its IUPAC name is 1-(3,3,3-trifluoroprop-1-enyl)cyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 1-(3,3,3-trifluoroprop-1-enyl)cyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 141210228 |
| Molecular Formula | C9H9F3O3S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 1-(3,3,3-trifluoroprop-1-enyl)cyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1(C=CC(F)(F)F)C=CC=CC1 |
| InChI | InChI=1S/C9H9F3O3S/c10-9(11,12)7-6-8(16(13,14)15)4-2-1-3-5-8/h1-4,6-7H,5H2,(H,13,14,15) |
| InChIKey | SIRVGCMNOGYPHI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|