C20H19NOS — CID 141211860
5-[bis(4-methylphenyl)methyl]thiophene-2-carboxamide (PubChem CID 141211860) has the molecular formula C20H19NOS and a molecular weight of 321.45 g/mol. Its IUPAC name is 5-[bis(4-methylphenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-[bis(4-methylphenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 141211860 |
| Molecular Formula | C20H19NOS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-[bis(4-methylphenyl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(c2ccc(C)cc2)c2ccc(C(N)=O)s2)cc1 |
| InChI | InChI=1S/C20H19NOS/c1-13-3-7-15(8-4-13)19(16-9-5-14(2)6-10-16)17-11-12-18(23-17)20(21)22/h3-12,19H,1-2H3,(H2,21,22) |
| InChIKey | GVTLBHHVBNRWQB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |