C24H18F4N2O2 — CID 141217433
2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,5-bis(3-methoxyphenyl)-1H-imidazole (PubChem CID 141217433) has the molecular formula C24H18F4N2O2 and a molecular weight of 442.41 g/mol. Its IUPAC name is 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,5-bis(3-methoxyphenyl)-1H-imidazole.
| Compound Name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,5-bis(3-methoxyphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 141217433 |
| Molecular Formula | C24H18F4N2O2 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]-4,5-bis(3-methoxyphenyl)-1H-imidazole |
| SMILES | COc1cccc(-c2nc(-c3ccc(C(F)(F)F)cc3F)[nH]c2-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C24H18F4N2O2/c1-31-17-7-3-5-14(11-17)21-22(15-6-4-8-18(12-15)32-2)30-23(29-21)19-10-9-16(13-20(19)25)24(26,27)28/h3-13H,1-2H3,(H,29,30) |
| InChIKey | OJEKEXXROHLQJV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|