C40H31F3N4O4 — CID 175398068
2-[4,5-bis(3-methoxyphenyl)-1H-imidazol-2-yl]-4,5-bis(3-methoxyphenyl)-1-(2,3,4-trifluorophenyl)imidazole (PubChem CID 175398068) has the molecular formula C40H31F3N4O4 and a molecular weight of 688.71 g/mol. Its IUPAC name is 2-[4,5-bis(3-methoxyphenyl)-1H-imidazol-2-yl]-4,5-bis(3-methoxyphenyl)-1-(2,3,4-trifluorophenyl)imidazole.
| Compound Name | 2-[4,5-bis(3-methoxyphenyl)-1H-imidazol-2-yl]-4,5-bis(3-methoxyphenyl)-1-(2,3,4-trifluorophenyl)imidazole |
|---|---|
| PubChem CID | 175398068 |
| Molecular Formula | C40H31F3N4O4 |
| Molecular Weight | 688.71 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | 2-[4,5-bis(3-methoxyphenyl)-1H-imidazol-2-yl]-4,5-bis(3-methoxyphenyl)-1-(2,3,4-trifluorophenyl)imidazole |
| SMILES | COc1cccc(-c2nc(-c3nc(-c4cccc(OC)c4)c(-c4cccc(OC)c4)n3-c3ccc(F)c(F)c3F)[nH]c2-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C40H31F3N4O4/c1-48-27-13-5-9-23(19-27)35-36(24-10-6-14-28(20-24)49-2)45-39(44-35)40-46-37(25-11-7-15-29(21-25)50-3)38(26-12-8-16-30(22-26)51-4)47(40)32-18-17-31(41)33(42)34(32)43/h5-22H,1-4H3,(H,44,45) |
| InChIKey | POQARJVAIOZWKZ-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.71 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|