C16H26O2 — CID 141221883
9,9,12-trimethyl-8,10-dioxadispiro[4.0.56.45]pentadec-13-ene (PubChem CID 141221883) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 9,9,12-trimethyl-8,10-dioxadispiro[4.0.56.45]pentadec-13-ene.
| Compound Name | 9,9,12-trimethyl-8,10-dioxadispiro[4.0.56.45]pentadec-13-ene |
|---|---|
| PubChem CID | 141221883 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 9,9,12-trimethyl-8,10-dioxadispiro[4.0.56.45]pentadec-13-ene |
| SMILES | CC1C=CCC2(CCCC2)C12COC(C)(C)OC2 |
| InChI | InChI=1S/C16H26O2/c1-13-7-6-10-15(8-4-5-9-15)16(13)11-17-14(2,3)18-12-16/h6-7,13H,4-5,8-12H2,1-3H3 |
| InChIKey | XHJXHGSCYAMDBP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|