C11H16O2 — CID 134895236
2-methylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] (PubChem CID 134895236) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene].
| Compound Name | 2-methylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] |
|---|---|
| PubChem CID | 134895236 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-methylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] |
| SMILES | CC1OCC2(CO1)CC1C=CC2C1 |
| InChI | InChI=1S/C11H16O2/c1-8-12-6-11(7-13-8)5-9-2-3-10(11)4-9/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | PALMQSONQNUQLO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|