C13H18O2 — CID 134857329
(1'R)-2,2-dimethyl-6'-methylidenespiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] (PubChem CID 134857329) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1'R)-2,2-dimethyl-6'-methylidenespiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene].
| Compound Name | (1'R)-2,2-dimethyl-6'-methylidenespiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] |
|---|---|
| PubChem CID | 134857329 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1'R)-2,2-dimethyl-6'-methylidenespiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] |
| SMILES | C=C1[C@H]2C=CC(C2)C12COC(C)(C)OC2 |
| InChI | InChI=1S/C13H18O2/c1-9-10-4-5-11(6-10)13(9)7-14-12(2,3)15-8-13/h4-5,10-11H,1,6-8H2,2-3H3/t10-,11?/m0/s1 |
| InChIKey | RXBUYXHQFCCCMC-VUWPPUDQSA-N |
| XLogP | 2.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|