C13H20O2 — CID 134879078
2-propan-2-ylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] (PubChem CID 134879078) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-propan-2-ylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene].
| Compound Name | 2-propan-2-ylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] |
|---|---|
| PubChem CID | 134879078 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-propan-2-ylspiro[1,3-dioxane-5,5'-bicyclo[2.2.1]hept-2-ene] |
| SMILES | CC(C)C1OCC2(CO1)CC1C=CC2C1 |
| InChI | InChI=1S/C13H20O2/c1-9(2)12-14-7-13(8-15-12)6-10-3-4-11(13)5-10/h3-4,9-12H,5-8H2,1-2H3 |
| InChIKey | BWNWUJPWIGTCGT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|