C46H42O8 — CID 141224421
[3-[4-[2-[3-(2-methylprop-2-enoyloxy)-3-naphthalen-2-yloxypropoxy]phenyl]phenoxy]-1-naphthalen-2-yloxypropyl] 2-methylprop-2-enoate (PubChem CID 141224421) has the molecular formula C46H42O8 and a molecular weight of 722.83 g/mol. Its IUPAC name is [3-[4-[2-[3-(2-methylprop-2-enoyloxy)-3-naphthalen-2-yloxypropoxy]phenyl]phenoxy]-1-naphthalen-2-yloxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-[2-[3-(2-methylprop-2-enoyloxy)-3-naphthalen-2-yloxypropoxy]phenyl]phenoxy]-1-naphthalen-2-yloxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141224421 |
| Molecular Formula | C46H42O8 |
| Molecular Weight | 722.83 g/mol |
| Exact Mass | 722.29 |
| IUPAC Name | [3-[4-[2-[3-(2-methylprop-2-enoyloxy)-3-naphthalen-2-yloxypropoxy]phenyl]phenoxy]-1-naphthalen-2-yloxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCOc1ccc(-c2ccccc2OCCC(OC(=O)C(=C)C)Oc2ccc3ccccc3c2)cc1)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C46H42O8/c1-31(2)45(47)53-43(51-39-23-17-33-11-5-7-13-36(33)29-39)25-27-49-38-21-19-35(20-22-38)41-15-9-10-16-42(41)50-28-26-44(54-46(48)32(3)4)52-40-24-18-34-12-6-8-14-37(34)30-40/h5-24,29-30,43-44H,1,3,25-28H2,2,4H3 |
| InChIKey | NFBPBIAORPMSAN-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.83 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|