C23H25NO3 — CID 67646102
1-[2-(4-cyanophenyl)phenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 67646102) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[2-(4-cyanophenyl)phenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 1-[2-(4-cyanophenyl)phenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67646102 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[2-(4-cyanophenyl)phenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCCC)Oc1ccccc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H25NO3/c1-4-5-6-11-22(27-23(25)17(2)3)26-21-10-8-7-9-20(21)19-14-12-18(16-24)13-15-19/h7-10,12-15,22H,2,4-6,11H2,1,3H3 |
| InChIKey | JNZYIRCKNMERNT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|