C17H28F6N2O4S2 — CID 141234390
bis(trifluoromethylsulfonyl)azanide;1-heptyl-1-propyl-2H-pyridin-1-ium (PubChem CID 141234390) has the molecular formula C17H28F6N2O4S2 and a molecular weight of 502.54 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-heptyl-1-propyl-2H-pyridin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-heptyl-1-propyl-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 141234390 |
| Molecular Formula | C17H28F6N2O4S2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-heptyl-1-propyl-2H-pyridin-1-ium |
| SMILES | CCCCCCC[N+]1(CCC)C=CC=CC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H28N.C2F6NO4S2/c1-3-5-6-7-9-13-16(12-4-2)14-10-8-11-15-16;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8,10-11,14H,3-7,9,12-13,15H2,1-2H3;/q+1;-1 |
| InChIKey | RSVHFLBNCHGFBM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|