C12H15N — CID 141235569
2-but-1-ynyl-N,6-dimethylaniline (PubChem CID 141235569) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-but-1-ynyl-N,6-dimethylaniline.
| Compound Name | 2-but-1-ynyl-N,6-dimethylaniline |
|---|---|
| PubChem CID | 141235569 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-but-1-ynyl-N,6-dimethylaniline |
| SMILES | CCC#Cc1cccc(C)c1NC |
| InChI | InChI=1S/C12H15N/c1-4-5-8-11-9-6-7-10(2)12(11)13-3/h6-7,9,13H,4H2,1-3H3 |
| InChIKey | PJTVALXFEYLJOR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|