C19H25ClO5 — CID 141238086
ethyl 2-[4-chloro-2-(1,3-dioxol-2-yl)phenoxy]-2-propylpentanoate (PubChem CID 141238086) has the molecular formula C19H25ClO5 and a molecular weight of 368.86 g/mol. Its IUPAC name is ethyl 2-[4-chloro-2-(1,3-dioxol-2-yl)phenoxy]-2-propylpentanoate.
| Compound Name | ethyl 2-[4-chloro-2-(1,3-dioxol-2-yl)phenoxy]-2-propylpentanoate |
|---|---|
| PubChem CID | 141238086 |
| Molecular Formula | C19H25ClO5 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl 2-[4-chloro-2-(1,3-dioxol-2-yl)phenoxy]-2-propylpentanoate |
| SMILES | CCCC(CCC)(Oc1ccc(Cl)cc1C1OC=CO1)C(=O)OCC |
| InChI | InChI=1S/C19H25ClO5/c1-4-9-19(10-5-2,18(21)22-6-3)25-16-8-7-14(20)13-15(16)17-23-11-12-24-17/h7-8,11-13,17H,4-6,9-10H2,1-3H3 |
| InChIKey | QGEXWIDEEXNNLH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |