C30H35Cl2NO6 — CID 59428069
tert-butyl (3E)-6-chloro-3-[[5-chloro-2-(4-ethoxycarbonylheptan-4-yloxy)phenyl]methylidene]-2-oxoindole-1-carboxylate (PubChem CID 59428069) has the molecular formula C30H35Cl2NO6 and a molecular weight of 576.52 g/mol. Its IUPAC name is tert-butyl (3E)-6-chloro-3-[[5-chloro-2-(4-ethoxycarbonylheptan-4-yloxy)phenyl]methylidene]-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3E)-6-chloro-3-[[5-chloro-2-(4-ethoxycarbonylheptan-4-yloxy)phenyl]methylidene]-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 59428069 |
| Molecular Formula | C30H35Cl2NO6 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | tert-butyl (3E)-6-chloro-3-[[5-chloro-2-(4-ethoxycarbonylheptan-4-yloxy)phenyl]methylidene]-2-oxoindole-1-carboxylate |
| SMILES | CCCC(CCC)(Oc1ccc(Cl)cc1/C=C1/C(=O)N(C(=O)OC(C)(C)C)c2cc(Cl)ccc21)C(=O)OCC |
| InChI | InChI=1S/C30H35Cl2NO6/c1-7-14-30(15-8-2,27(35)37-9-3)38-25-13-11-20(31)16-19(25)17-23-22-12-10-21(32)18-24(22)33(26(23)34)28(36)39-29(4,5)6/h10-13,16-18H,7-9,14-15H2,1-6H3/b23-17+ |
| InChIKey | SLCXPBFRMZXZMP-HAVVHWLPSA-N |
| XLogP | 8.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|