C26H27Cl2NO6 — CID 86632060
tert-butyl (3Z)-6-chloro-3-[[5-chloro-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)phenyl]methylidene]-2-oxoindole-1-carboxylate (PubChem CID 86632060) has the molecular formula C26H27Cl2NO6 and a molecular weight of 520.41 g/mol. Its IUPAC name is tert-butyl (3Z)-6-chloro-3-[[5-chloro-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)phenyl]methylidene]-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3Z)-6-chloro-3-[[5-chloro-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)phenyl]methylidene]-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 86632060 |
| Molecular Formula | C26H27Cl2NO6 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | tert-butyl (3Z)-6-chloro-3-[[5-chloro-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)phenyl]methylidene]-2-oxoindole-1-carboxylate |
| SMILES | COC(=O)C(C)(C)COc1ccc(Cl)cc1/C=C1\C(=O)N(C(=O)OC(C)(C)C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H27Cl2NO6/c1-25(2,3)35-24(32)29-20-13-17(28)7-9-18(20)19(22(29)30)12-15-11-16(27)8-10-21(15)34-14-26(4,5)23(31)33-6/h7-13H,14H2,1-6H3/b19-12- |
| InChIKey | DHUMBMOLFMFQCZ-UNOMPAQXSA-N |
| XLogP | 6.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|