C16H16ClNO5 — CID 177470957
tert-butyl (3E)-6-chloro-3-(2-methoxy-2-oxoethylidene)-2-oxoindole-1-carboxylate (PubChem CID 177470957) has the molecular formula C16H16ClNO5 and a molecular weight of 337.76 g/mol. Its IUPAC name is tert-butyl (3E)-6-chloro-3-(2-methoxy-2-oxoethylidene)-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3E)-6-chloro-3-(2-methoxy-2-oxoethylidene)-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 177470957 |
| Molecular Formula | C16H16ClNO5 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | tert-butyl (3E)-6-chloro-3-(2-methoxy-2-oxoethylidene)-2-oxoindole-1-carboxylate |
| SMILES | COC(=O)/C=C1/C(=O)N(C(=O)OC(C)(C)C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H16ClNO5/c1-16(2,3)23-15(21)18-12-7-9(17)5-6-10(12)11(14(18)20)8-13(19)22-4/h5-8H,1-4H3/b11-8+ |
| InChIKey | DFAHBHNGJTWXDX-DHZHZOJOSA-N |
| XLogP | 3.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|