C20H16Cl2INO3 — CID 140522001
tert-butyl (3Z)-6-chloro-3-[(5-chloro-2-iodophenyl)methylidene]-2-oxoindole-1-carboxylate (PubChem CID 140522001) has the molecular formula C20H16Cl2INO3 and a molecular weight of 516.16 g/mol. Its IUPAC name is tert-butyl (3Z)-6-chloro-3-[(5-chloro-2-iodophenyl)methylidene]-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3Z)-6-chloro-3-[(5-chloro-2-iodophenyl)methylidene]-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 140522001 |
| Molecular Formula | C20H16Cl2INO3 |
| Molecular Weight | 516.16 g/mol |
| Exact Mass | 514.96 |
| IUPAC Name | tert-butyl (3Z)-6-chloro-3-[(5-chloro-2-iodophenyl)methylidene]-2-oxoindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)/C(=C\c2cc(Cl)ccc2I)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H16Cl2INO3/c1-20(2,3)27-19(26)24-17-10-13(22)4-6-14(17)15(18(24)25)9-11-8-12(21)5-7-16(11)23/h4-10H,1-3H3/b15-9- |
| InChIKey | VHKBLOIJEQIWMI-DHDCSXOGSA-N |
| XLogP | 6.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.16 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|