C18H12ClNO4 — CID 175214791
4-[(E)-(1-acetyl-6-chloro-2-oxoindol-3-ylidene)methyl]benzoic acid (PubChem CID 175214791) has the molecular formula C18H12ClNO4 and a molecular weight of 341.75 g/mol. Its IUPAC name is 4-[(E)-(1-acetyl-6-chloro-2-oxoindol-3-ylidene)methyl]benzoic acid.
| Compound Name | 4-[(E)-(1-acetyl-6-chloro-2-oxoindol-3-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 175214791 |
| Molecular Formula | C18H12ClNO4 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[(E)-(1-acetyl-6-chloro-2-oxoindol-3-ylidene)methyl]benzoic acid |
| SMILES | CC(=O)N1C(=O)/C(=C/c2ccc(C(=O)O)cc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H12ClNO4/c1-10(21)20-16-9-13(19)6-7-14(16)15(17(20)22)8-11-2-4-12(5-3-11)18(23)24/h2-9H,1H3,(H,23,24)/b15-8+ |
| InChIKey | BVXOSWXSTKROMS-OVCLIPMQSA-N |
| XLogP | 3.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|