C28H23BrClNO6 — CID 131728295
tert-butyl (3Z)-3-[[5-bromo-2-(4-methoxycarbonylphenoxy)phenyl]methylidene]-6-chloro-2-oxoindole-1-carboxylate (PubChem CID 131728295) has the molecular formula C28H23BrClNO6 and a molecular weight of 584.85 g/mol. Its IUPAC name is tert-butyl (3Z)-3-[[5-bromo-2-(4-methoxycarbonylphenoxy)phenyl]methylidene]-6-chloro-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3Z)-3-[[5-bromo-2-(4-methoxycarbonylphenoxy)phenyl]methylidene]-6-chloro-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 131728295 |
| Molecular Formula | C28H23BrClNO6 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | tert-butyl (3Z)-3-[[5-bromo-2-(4-methoxycarbonylphenoxy)phenyl]methylidene]-6-chloro-2-oxoindole-1-carboxylate |
| SMILES | COC(=O)c1ccc(Oc2ccc(Br)cc2/C=C2\C(=O)N(C(=O)OC(C)(C)C)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C28H23BrClNO6/c1-28(2,3)37-27(34)31-23-15-19(30)8-11-21(23)22(25(31)32)14-17-13-18(29)7-12-24(17)36-20-9-5-16(6-10-20)26(33)35-4/h5-15H,1-4H3/b22-14- |
| InChIKey | FYDBRPAGZVTWPY-HMAPJEAMSA-N |
| XLogP | 7.50 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|