C20H16Cl2FNO3 — CID 86615088
tert-butyl (3Z)-6-chloro-3-[(3-chlorophenyl)methylidene]-5-fluoro-2-oxoindole-1-carboxylate (PubChem CID 86615088) has the molecular formula C20H16Cl2FNO3 and a molecular weight of 408.26 g/mol. Its IUPAC name is tert-butyl (3Z)-6-chloro-3-[(3-chlorophenyl)methylidene]-5-fluoro-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3Z)-6-chloro-3-[(3-chlorophenyl)methylidene]-5-fluoro-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 86615088 |
| Molecular Formula | C20H16Cl2FNO3 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | tert-butyl (3Z)-6-chloro-3-[(3-chlorophenyl)methylidene]-5-fluoro-2-oxoindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)/C(=C\c2cccc(Cl)c2)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C20H16Cl2FNO3/c1-20(2,3)27-19(26)24-17-10-15(22)16(23)9-13(17)14(18(24)25)8-11-5-4-6-12(21)7-11/h4-10H,1-3H3/b14-8- |
| InChIKey | GYUDHQPSHYFGBL-ZSOIEALJSA-N |
| XLogP | 5.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|