About (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate
(ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate (PubChem CID 141238095) has the molecular formula C11H22O3S
and a molecular weight of 234.36 g/mol. Its IUPAC name is (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate.
Molecular Properties
| Compound Name | (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate |
| PubChem CID | 141238095 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate |
| SMILES | CCS(C)(C)(=O)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H22O3S/c1-4-15(2,3,13)14-11(12)10-8-6-5-7-9-10/h10H,4-9H2,1-3H3 |
| InChIKey | MFRIQJIJXWIKRL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate?
The IUPAC name of (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate (CID 141238095) is (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate.
What is the SMILES notation for (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate?
The canonical SMILES for (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate is CCS(C)(C)(=O)OC(=O)C1CCCCC1.
What is the InChIKey of (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate?
The InChIKey is MFRIQJIJXWIKRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3S/c1-4-15(2,3,13)14-11(12)10-8-6-5-7-9-10/h10H,4-9H2,1-3H3.
What are the key properties of (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate?
(ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate has a molecular weight of 234.36 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (ethyl-dimethyl-oxo-λ6-sulfanyl) cyclohexanecarboxylate is sourced from PubChem (CID 141238095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).