About 1-chlorobutyl cyclohexanecarboxylate
1-chlorobutyl cyclohexanecarboxylate (PubChem CID 67231020) has the molecular formula C11H19ClO2
and a molecular weight of 218.72 g/mol. Its IUPAC name is 1-chlorobutyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | 1-chlorobutyl cyclohexanecarboxylate |
| PubChem CID | 67231020 |
| Molecular Formula | C11H19ClO2 |
| Molecular Weight | 218.72 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-chlorobutyl cyclohexanecarboxylate |
| SMILES | CCCC(Cl)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H19ClO2/c1-2-6-10(12)14-11(13)9-7-4-3-5-8-9/h9-10H,2-8H2,1H3 |
| InChIKey | FDKWHMWJUYGSCI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.72 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorobutyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorobutyl cyclohexanecarboxylate?
The IUPAC name of 1-chlorobutyl cyclohexanecarboxylate (CID 67231020) is 1-chlorobutyl cyclohexanecarboxylate.
What is the SMILES notation for 1-chlorobutyl cyclohexanecarboxylate?
The canonical SMILES for 1-chlorobutyl cyclohexanecarboxylate is CCCC(Cl)OC(=O)C1CCCCC1.
What is the InChIKey of 1-chlorobutyl cyclohexanecarboxylate?
The InChIKey is FDKWHMWJUYGSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClO2/c1-2-6-10(12)14-11(13)9-7-4-3-5-8-9/h9-10H,2-8H2,1H3.
What are the key properties of 1-chlorobutyl cyclohexanecarboxylate?
1-chlorobutyl cyclohexanecarboxylate has a molecular weight of 218.72 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorobutyl cyclohexanecarboxylate is sourced from PubChem (CID 67231020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).