About 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate
1-carbonochloridoylperoxybutyl cyclopentanecarboxylate (PubChem CID 86598003) has the molecular formula C11H17ClO5
and a molecular weight of 264.70 g/mol. Its IUPAC name is 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate.
Molecular Properties
| Compound Name | 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate |
| PubChem CID | 86598003 |
| Molecular Formula | C11H17ClO5 |
| Molecular Weight | 264.70 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate |
| SMILES | CCCC(OOC(=O)Cl)OC(=O)C1CCCC1 |
| InChI | InChI=1S/C11H17ClO5/c1-2-5-9(16-17-11(12)14)15-10(13)8-6-3-4-7-8/h8-9H,2-7H2,1H3 |
| InChIKey | DWUGNDFDMRNJPD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate?
The IUPAC name of 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate (CID 86598003) is 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate.
What is the SMILES notation for 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate?
The canonical SMILES for 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate is CCCC(OOC(=O)Cl)OC(=O)C1CCCC1.
What is the InChIKey of 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate?
The InChIKey is DWUGNDFDMRNJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClO5/c1-2-5-9(16-17-11(12)14)15-10(13)8-6-3-4-7-8/h8-9H,2-7H2,1H3.
What are the key properties of 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate?
1-carbonochloridoylperoxybutyl cyclopentanecarboxylate has a molecular weight of 264.70 g/mol, XLogP of 3.15, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbonochloridoylperoxybutyl cyclopentanecarboxylate is sourced from PubChem (CID 86598003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).