C17H20N2O3 — CID 141241668
4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]pyridine-2-carbaldehyde (PubChem CID 141241668) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]pyridine-2-carbaldehyde.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 141241668 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]pyridine-2-carbaldehyde |
| SMILES | COc1ccc(CCN(C)c2ccnc(C=O)c2)cc1OC |
| InChI | InChI=1S/C17H20N2O3/c1-19(15-6-8-18-14(11-15)12-20)9-7-13-4-5-16(21-2)17(10-13)22-3/h4-6,8,10-12H,7,9H2,1-3H3 |
| InChIKey | WUJXIUOOEDHPSM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|