C24H27N3O2 — CID 75966783
2-[2-(4-aminophenyl)ethenyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpyridin-4-amine (PubChem CID 75966783) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)ethenyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpyridin-4-amine.
| Compound Name | 2-[2-(4-aminophenyl)ethenyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpyridin-4-amine |
|---|---|
| PubChem CID | 75966783 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 2-[2-(4-aminophenyl)ethenyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpyridin-4-amine |
| SMILES | COc1ccc(CCN(C)c2ccnc(C=Cc3ccc(N)cc3)c2)cc1OC |
| InChI | InChI=1S/C24H27N3O2/c1-27(15-13-19-7-11-23(28-2)24(16-19)29-3)22-12-14-26-21(17-22)10-6-18-4-8-20(25)9-5-18/h4-12,14,16-17H,13,15,25H2,1-3H3 |
| InChIKey | SRJUUKSHAVHUSG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|