C10H9ClO4 — CID 141243491
methyl 2-chloro-3-methoxy-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylate (PubChem CID 141243491) has the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. Its IUPAC name is methyl 2-chloro-3-methoxy-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 2-chloro-3-methoxy-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 141243491 |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | methyl 2-chloro-3-methoxy-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(Cl)C(OC)C(=C=O)C=C1 |
| InChI | InChI=1S/C10H9ClO4/c1-14-9-6(5-12)3-4-7(8(9)11)10(13)15-2/h3-4,9H,1-2H3 |
| InChIKey | XZQRHCPDYYTEEN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|