C17H28O10S4 — CID 141246080
[2-(hydroxymethyl)-2-(3-sulfanylpropanoyloxymethyl)-3-[3-(3-sulfanylpropanoylsulfonyl)propanoyloxy]propyl] 3-sulfanylpropanoate (PubChem CID 141246080) has the molecular formula C17H28O10S4 and a molecular weight of 520.67 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2-(3-sulfanylpropanoyloxymethyl)-3-[3-(3-sulfanylpropanoylsulfonyl)propanoyloxy]propyl] 3-sulfanylpropanoate.
| Compound Name | [2-(hydroxymethyl)-2-(3-sulfanylpropanoyloxymethyl)-3-[3-(3-sulfanylpropanoylsulfonyl)propanoyloxy]propyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 141246080 |
| Molecular Formula | C17H28O10S4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | [2-(hydroxymethyl)-2-(3-sulfanylpropanoyloxymethyl)-3-[3-(3-sulfanylpropanoylsulfonyl)propanoyloxy]propyl] 3-sulfanylpropanoate |
| SMILES | O=C(CCS)OCC(CO)(COC(=O)CCS)COC(=O)CCS(=O)(=O)C(=O)CCS |
| InChI | InChI=1S/C17H28O10S4/c18-9-17(10-25-13(19)1-5-28,11-26-14(20)2-6-29)12-27-15(21)4-8-31(23,24)16(22)3-7-30/h18,28-30H,1-12H2 |
| InChIKey | VWDQQYLFPRGBHU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|