C17H28O8S4 — CID 154018740
4-(hydroxymethyl)-2,6-bis(sulfanylmethyl)-4-[3-(3-sulfanylpropanoylsulfanyl)propanoyloxymethyl]heptanedioic acid (PubChem CID 154018740) has the molecular formula C17H28O8S4 and a molecular weight of 488.67 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,6-bis(sulfanylmethyl)-4-[3-(3-sulfanylpropanoylsulfanyl)propanoyloxymethyl]heptanedioic acid.
| Compound Name | 4-(hydroxymethyl)-2,6-bis(sulfanylmethyl)-4-[3-(3-sulfanylpropanoylsulfanyl)propanoyloxymethyl]heptanedioic acid |
|---|---|
| PubChem CID | 154018740 |
| Molecular Formula | C17H28O8S4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 4-(hydroxymethyl)-2,6-bis(sulfanylmethyl)-4-[3-(3-sulfanylpropanoylsulfanyl)propanoyloxymethyl]heptanedioic acid |
| SMILES | O=C(CCSC(=O)CCS)OCC(CO)(CC(CS)C(=O)O)CC(CS)C(=O)O |
| InChI | InChI=1S/C17H28O8S4/c18-9-17(5-11(7-27)15(21)22,6-12(8-28)16(23)24)10-25-13(19)2-4-29-14(20)1-3-26/h11-12,18,26-28H,1-10H2,(H,21,22)(H,23,24) |
| InChIKey | MWBLOUZZGSLZOH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|