C13H28N3O4+ — CID 141248223
[(4S)-4,8-diamino-2-(carboxymethyl)-2-hydroxy-3-oxooctyl]-trimethylazanium (PubChem CID 141248223) has the molecular formula C13H28N3O4+ and a molecular weight of 290.38 g/mol. Its IUPAC name is [(4S)-4,8-diamino-2-(carboxymethyl)-2-hydroxy-3-oxooctyl]-trimethylazanium.
| Compound Name | [(4S)-4,8-diamino-2-(carboxymethyl)-2-hydroxy-3-oxooctyl]-trimethylazanium |
|---|---|
| PubChem CID | 141248223 |
| Molecular Formula | C13H28N3O4+ |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | [(4S)-4,8-diamino-2-(carboxymethyl)-2-hydroxy-3-oxooctyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)(CC(=O)O)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C13H27N3O4/c1-16(2,3)9-13(20,8-11(17)18)12(19)10(15)6-4-5-7-14/h10,20H,4-9,14-15H2,1-3H3/p+1/t10-,13?/m0/s1 |
| InChIKey | QERHHQSKGGIKQH-NKUHCKNESA-O |
| XLogP | -1.08 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|