C18H34N4O10 — CID 87671849
[(2S)-2,6-diaminohexanoyl] (2S)-2,6-diaminohexanoate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87671849) has the molecular formula C18H34N4O10 and a molecular weight of 466.49 g/mol. Its IUPAC name is [(2S)-2,6-diaminohexanoyl] (2S)-2,6-diaminohexanoate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | [(2S)-2,6-diaminohexanoyl] (2S)-2,6-diaminohexanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87671849 |
| Molecular Formula | C18H34N4O10 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | [(2S)-2,6-diaminohexanoyl] (2S)-2,6-diaminohexanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | NCCCC[C@H](N)C(=O)OC(=O)[C@@H](N)CCCCN.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H26N4O3.C6H8O7/c13-7-3-1-5-9(15)11(17)19-12(18)10(16)6-2-4-8-14;7-3(8)1-6(13,5(11)12)2-4(9)10/h9-10H,1-8,13-16H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t9-,10-;/m0./s1 |
| InChIKey | DCTNFXDCQHAAHI-IYPAPVHQSA-N |
| XLogP | -2.28 |
| TPSA | 279.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|