C16H32N4O8 — CID 88735096
[(2S)-2,6-diaminohexanoyl] (2S)-2,6-diaminohexanoate;2-hydroxybutanedioic acid (PubChem CID 88735096) has the molecular formula C16H32N4O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(2S)-2,6-diaminohexanoyl] (2S)-2,6-diaminohexanoate;2-hydroxybutanedioic acid.
| Compound Name | [(2S)-2,6-diaminohexanoyl] (2S)-2,6-diaminohexanoate;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 88735096 |
| Molecular Formula | C16H32N4O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [(2S)-2,6-diaminohexanoyl] (2S)-2,6-diaminohexanoate;2-hydroxybutanedioic acid |
| SMILES | NCCCC[C@H](N)C(=O)OC(=O)[C@@H](N)CCCCN.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C12H26N4O3.C4H6O5/c13-7-3-1-5-9(15)11(17)19-12(18)10(16)6-2-4-8-14;5-2(4(8)9)1-3(6)7/h9-10H,1-8,13-16H2;2,5H,1H2,(H,6,7)(H,8,9)/t9-,10-;/m0./s1 |
| InChIKey | UDBXJXYRMABRRF-IYPAPVHQSA-N |
| XLogP | -2.12 |
| TPSA | 242.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|