C10H19N3O5 — CID 142779903
4-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxy-4-oxobutanoic acid (PubChem CID 142779903) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 142779903 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxy-4-oxobutanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)NC(=O)C(O)CC(=O)O |
| InChI | InChI=1S/C10H19N3O5/c11-4-2-1-3-6(12)9(17)13-10(18)7(14)5-8(15)16/h6-7,14H,1-5,11-12H2,(H,15,16)(H,13,17,18)/t6-,7?/m0/s1 |
| InChIKey | GXMCWAUVNUGFGS-PKPIPKONSA-N |
| XLogP | -2.08 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|