C16H26ClNO2Si — CID 141254217
[(6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-chloro-5,6,7,8-tetrahydroquinolin-6-yl]methanol (PubChem CID 141254217) has the molecular formula C16H26ClNO2Si and a molecular weight of 327.93 g/mol. Its IUPAC name is [(6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-chloro-5,6,7,8-tetrahydroquinolin-6-yl]methanol.
| Compound Name | [(6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-chloro-5,6,7,8-tetrahydroquinolin-6-yl]methanol |
|---|---|
| PubChem CID | 141254217 |
| Molecular Formula | C16H26ClNO2Si |
| Molecular Weight | 327.93 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [(6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-chloro-5,6,7,8-tetrahydroquinolin-6-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](CO)Cc2cc(Cl)cnc21 |
| InChI | InChI=1S/C16H26ClNO2Si/c1-16(2,3)21(4,5)20-14-7-11(10-19)6-12-8-13(17)9-18-15(12)14/h8-9,11,14,19H,6-7,10H2,1-5H3/t11-,14+/m0/s1 |
| InChIKey | IEADWYMQDAEJIS-SMDDNHRTSA-N |
| XLogP | 4.35 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|