About but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate
but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 141255447) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate.
Molecular Properties
| Compound Name | but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| PubChem CID | 141255447 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC=CCOC(=O)C1(C)CCC2OC2C1 |
| InChI | InChI=1S/C12H18O3/c1-3-4-7-14-11(13)12(2)6-5-9-10(8-12)15-9/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | SSHYZZFPEUAMEL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The IUPAC name of but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate (CID 141255447) is but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate.
What is the SMILES notation for but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The canonical SMILES for but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate is CC=CCOC(=O)C1(C)CCC2OC2C1.
What is the InChIKey of but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The InChIKey is SSHYZZFPEUAMEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-3-4-7-14-11(13)12(2)6-5-9-10(8-12)15-9/h3-4,9-10H,5-8H2,1-2H3.
What are the key properties of but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate?
but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate has a molecular weight of 210.27 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enyl 3-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate is sourced from PubChem (CID 141255447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).