C13H23NO6 — CID 141257408
ethyl N-(3,4-dihydroxybutyl)-N-[2-(3-oxobut-1-en-2-yloxy)ethyl]carbamate (PubChem CID 141257408) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl N-(3,4-dihydroxybutyl)-N-[2-(3-oxobut-1-en-2-yloxy)ethyl]carbamate.
| Compound Name | ethyl N-(3,4-dihydroxybutyl)-N-[2-(3-oxobut-1-en-2-yloxy)ethyl]carbamate |
|---|---|
| PubChem CID | 141257408 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | ethyl N-(3,4-dihydroxybutyl)-N-[2-(3-oxobut-1-en-2-yloxy)ethyl]carbamate |
| SMILES | C=C(OCCN(CCC(O)CO)C(=O)OCC)C(C)=O |
| InChI | InChI=1S/C13H23NO6/c1-4-19-13(18)14(6-5-12(17)9-15)7-8-20-11(3)10(2)16/h12,15,17H,3-9H2,1-2H3 |
| InChIKey | TUGRYODFMORLPJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|