C12H21NO7 — CID 174505022
1-[2,3-dihydroxypropoxy(ethoxycarbonyl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 174505022) has the molecular formula C12H21NO7 and a molecular weight of 291.30 g/mol. Its IUPAC name is 1-[2,3-dihydroxypropoxy(ethoxycarbonyl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 1-[2,3-dihydroxypropoxy(ethoxycarbonyl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174505022 |
| Molecular Formula | C12H21NO7 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-[2,3-dihydroxypropoxy(ethoxycarbonyl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)N(OCC(O)CO)C(=O)OCC |
| InChI | InChI=1S/C12H21NO7/c1-5-18-12(17)13(19-7-10(15)6-14)9(4)20-11(16)8(2)3/h9-10,14-15H,2,5-7H2,1,3-4H3 |
| InChIKey | MDAAXDGZESOJPA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|