C15H12O4 — CID 141258282
(2-hydroxy-4-methoxyphenyl)-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]methanone (PubChem CID 141258282) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2-hydroxy-4-methoxyphenyl)-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]methanone.
| Compound Name | (2-hydroxy-4-methoxyphenyl)-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]methanone |
|---|---|
| PubChem CID | 141258282 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]methanone |
| SMILES | COc1ccc(C(=O)C2C=CC=CC2=C=O)c(O)c1 |
| InChI | InChI=1S/C15H12O4/c1-19-11-6-7-13(14(17)8-11)15(18)12-5-3-2-4-10(12)9-16/h2-8,12,17H,1H3 |
| InChIKey | CWGNIYLEAXYXAS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|