C41H50N2O2 — CID 141259113
4-[4-[1-[4-(4-aminophenoxy)phenyl]-4-(1-pentylcyclohexyl)cyclohexyl]phenoxy]aniline (PubChem CID 141259113) has the molecular formula C41H50N2O2 and a molecular weight of 602.86 g/mol. Its IUPAC name is 4-[4-[1-[4-(4-aminophenoxy)phenyl]-4-(1-pentylcyclohexyl)cyclohexyl]phenoxy]aniline.
| Compound Name | 4-[4-[1-[4-(4-aminophenoxy)phenyl]-4-(1-pentylcyclohexyl)cyclohexyl]phenoxy]aniline |
|---|---|
| PubChem CID | 141259113 |
| Molecular Formula | C41H50N2O2 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | 4-[4-[1-[4-(4-aminophenoxy)phenyl]-4-(1-pentylcyclohexyl)cyclohexyl]phenoxy]aniline |
| SMILES | CCCCCC1(C2CCC(c3ccc(Oc4ccc(N)cc4)cc3)(c3ccc(Oc4ccc(N)cc4)cc3)CC2)CCCCC1 |
| InChI | InChI=1S/C41H50N2O2/c1-2-3-5-26-40(27-6-4-7-28-40)31-24-29-41(30-25-31,32-8-16-36(17-9-32)44-38-20-12-34(42)13-21-38)33-10-18-37(19-11-33)45-39-22-14-35(43)15-23-39/h8-23,31H,2-7,24-30,42-43H2,1H3 |
| InChIKey | DCUAEQPYCADGPG-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|