C26H26F3N3O — CID 141260138
N-[2-(azepan-3-yl)-3-pyridinyl]-4-methyl-3-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 141260138) has the molecular formula C26H26F3N3O and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[2-(azepan-3-yl)-3-pyridinyl]-4-methyl-3-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[2-(azepan-3-yl)-3-pyridinyl]-4-methyl-3-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 141260138 |
| Molecular Formula | C26H26F3N3O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-[2-(azepan-3-yl)-3-pyridinyl]-4-methyl-3-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccnc2C2CCCCNC2)cc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H26F3N3O/c1-17-7-8-19(15-22(17)18-9-11-21(12-10-18)26(27,28)29)25(33)32-23-6-4-14-31-24(23)20-5-2-3-13-30-16-20/h4,6-12,14-15,20,30H,2-3,5,13,16H2,1H3,(H,32,33) |
| InChIKey | XXRXPMISBLQOMQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |