C30H38ClN3O3Si — CID 141263526
[5-[5-[(4-chlorophenyl)methoxy]-4-methoxy-2-pyridinyl]-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol (PubChem CID 141263526) has the molecular formula C30H38ClN3O3Si and a molecular weight of 552.19 g/mol. Its IUPAC name is [5-[5-[(4-chlorophenyl)methoxy]-4-methoxy-2-pyridinyl]-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol.
| Compound Name | [5-[5-[(4-chlorophenyl)methoxy]-4-methoxy-2-pyridinyl]-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 141263526 |
| Molecular Formula | C30H38ClN3O3Si |
| Molecular Weight | 552.19 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | [5-[5-[(4-chlorophenyl)methoxy]-4-methoxy-2-pyridinyl]-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol |
| SMILES | COc1cc(-c2cnc3c(c2)c(CO)cn3[Si](C(C)C)(C(C)C)C(C)C)ncc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H38ClN3O3Si/c1-19(2)38(20(3)4,21(5)6)34-16-24(17-35)26-12-23(14-33-30(26)34)27-13-28(36-7)29(15-32-27)37-18-22-8-10-25(31)11-9-22/h8-16,19-21,35H,17-18H2,1-7H3 |
| InChIKey | RRYUJYMMIVKQDE-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.19 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|