C12H15F3N2O2 — CID 141264603
2-[2-oxo-4-(2,2,2-trifluoroethyl)-3H-azepin-1-yl]butanamide (PubChem CID 141264603) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-[2-oxo-4-(2,2,2-trifluoroethyl)-3H-azepin-1-yl]butanamide.
| Compound Name | 2-[2-oxo-4-(2,2,2-trifluoroethyl)-3H-azepin-1-yl]butanamide |
|---|---|
| PubChem CID | 141264603 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[2-oxo-4-(2,2,2-trifluoroethyl)-3H-azepin-1-yl]butanamide |
| SMILES | CCC(C(N)=O)N1C=CC=C(CC(F)(F)F)CC1=O |
| InChI | InChI=1S/C12H15F3N2O2/c1-2-9(11(16)19)17-5-3-4-8(6-10(17)18)7-12(13,14)15/h3-5,9H,2,6-7H2,1H3,(H2,16,19) |
| InChIKey | CLIHCMZRVOTPMX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |